CAS 2253632-31-2 is the registry number for N,1-Dimethyl-1H-indol-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N,1-dimethylindol-3-amine;hydrochloride (CAS 2253632-31-2) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: N,1-dimethylindol-3-amine;hydrochloride. InChIKey: HMQUUPYNVXDPMC-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | N,1-dimethylindol-3-amine;hydrochloride |
| InChIKey | HMQUUPYNVXDPMC-UHFFFAOYSA-N |
| SMILES | CNC1=CN(C2=CC=CC=C21)C.Cl |
Computed by PubChem (NCBI)