Products 2253640-51-4
CAS 2253640-51-4 is the registry number for rac-Methyl (3aR,7aS)-octahydro-1H-indole-3a-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylate;hydrochloride (CAS 2253640-51-4) is a chemical compound with the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. IUPAC name: methyl (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylate;hydrochloride. InChIKey: PTRZOWQWTJWLGR-KXNXZCPBSA-N.
| Molecular formula | C10H18ClNO2 |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | methyl (3aR,7aS)-1,2,3,4,5,6,7,7a-octahydroindole-3a-carboxylate;hydrochloride |
| InChIKey | PTRZOWQWTJWLGR-KXNXZCPBSA-N |
| SMILES | COC(=O)[C@@]12CCCC[C@@H]1NCC2.Cl |
Computed by PubChem (NCBI)