Products 2253771-13-8

CAS 2253771-13-8 is the registry number for H-L-Lys(Heptanoyl)-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

(2S)-2-amino-6-(heptanoylamino)hexanoic acid (CAS 2253771-13-8) is a chemical compound with the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. IUPAC name: (2S)-2-amino-6-(heptanoylamino)hexanoic acid. InChIKey: MIPVNXBAKZBUIK-NSHDSACASA-N.

Identity
Molecular formulaC13H26N2O3
Molecular weight258.36 g/mol
IUPAC name(2S)-2-amino-6-(heptanoylamino)hexanoic acid
InChIKeyMIPVNXBAKZBUIK-NSHDSACASA-N
SMILESCCCCCCC(=O)NCCCC[C@@H](C(=O)O)N

Computed by PubChem (NCBI)