CAS 22539-55-5 appears in our catalog under these names: 8–Chloro–5–nitroquinoline, 8-Chloro-5-nitroquinoline 98%, 8-Chloro-5-nitroquinoline, 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
8-chloro-5-nitroquinoline (CAS 22539-55-5) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 8-chloro-5-nitroquinoline. InChIKey: XSJNIKQCTPVESL-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 8-chloro-5-nitroquinoline |
| InChIKey | XSJNIKQCTPVESL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)