CAS 22568-47-4 is the registry number for 1,2-Dimethoxy-4-((E)-2-nitroethenyl)benzene. Offered by: Biosynth. Available pack sizes: 2,5g, 0,25g.
1,2-dimethoxy-4-[(E)-2-nitroethenyl]benzene (CAS 22568-47-4) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 1,2-dimethoxy-4-[(E)-2-nitroethenyl]benzene. InChIKey: SYJMYDMKPSZMSB-AATRIKPKSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 1,2-dimethoxy-4-[(E)-2-nitroethenyl]benzene |
| InChIKey | SYJMYDMKPSZMSB-AATRIKPKSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/[N+](=O)[O-])OC |
Computed by PubChem (NCBI)