CAS 2260933-06-8 is the registry number for 4-Chloro-1,7-naphthyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 2,5g, 1g.
4-chloro-1,7-naphthyridine-2-carboxylic acid (CAS 2260933-06-8) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 4-chloro-1,7-naphthyridine-2-carboxylic acid. InChIKey: UWDPCVHSTBDNKK-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 4-chloro-1,7-naphthyridine-2-carboxylic acid |
| InChIKey | UWDPCVHSTBDNKK-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=CC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)