Products 2260933-06-8

CAS 2260933-06-8 is the registry number for 4-Chloro-1,7-naphthyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 2,5g, 1g.

Structural formula: {0} (CAS {1})

4-chloro-1,7-naphthyridine-2-carboxylic acid (CAS 2260933-06-8) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 4-chloro-1,7-naphthyridine-2-carboxylic acid. InChIKey: UWDPCVHSTBDNKK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClN2O2
Molecular weight208.60 g/mol
IUPAC name4-chloro-1,7-naphthyridine-2-carboxylic acid
InChIKeyUWDPCVHSTBDNKK-UHFFFAOYSA-N
SMILESC1=CN=CC2=C1C(=CC(=N2)C(=O)O)Cl

Computed by PubChem (NCBI)