Products 2260936-99-8
CAS 2260936-99-8 is the registry number for 6-(Dimethylamino)-3-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(dimethylamino)-3-phenyl-1H-1,3,5-triazine-2,4-dione (CAS 2260936-99-8) is a chemical compound with the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. IUPAC name: 6-(dimethylamino)-3-phenyl-1H-1,3,5-triazine-2,4-dione. InChIKey: WLYULBIFSRFUBT-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O2 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | 6-(dimethylamino)-3-phenyl-1H-1,3,5-triazine-2,4-dione |
| InChIKey | WLYULBIFSRFUBT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=O)N(C(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)