Products 2262385-84-0
CAS 2262385-84-0 is the registry number for Salmeterol Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-[2-hydroxy-3-(hydroxymethyl)phenyl]ethanone (CAS 2262385-84-0) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-1-[2-hydroxy-3-(hydroxymethyl)phenyl]ethanone. InChIKey: QUJBTIHBYVQQGQ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-1-[2-hydroxy-3-(hydroxymethyl)phenyl]ethanone |
| InChIKey | QUJBTIHBYVQQGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)CBr)O)CO |
Computed by PubChem (NCBI)