CAS 22701-17-3 appears in our catalog under these names: 5-Hydroxyflavanone, 95%, 5-Hydroxyflavanone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 2000mg.
5-hydroxy-2-phenyl-2,3-dihydrochromen-4-one (CAS 22701-17-3) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 5-hydroxy-2-phenyl-2,3-dihydrochromen-4-one. InChIKey: CRWQDRUCLPDWEK-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 5-hydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| InChIKey | CRWQDRUCLPDWEK-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC(=C2C1=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)