CAS 22711-21-3 appears in our catalog under these names: 1-(4-Methoxyphenyl)-2-phenylethane-1,2-dione, 98%, P-methoxybenzil, 97%, 1–(4–Methoxyphenyl)–2–phenylethane–1,2–dione, 4-Methoxybenzil, 1-(4-Methoxyphenyl)-2-phenylethane-1,2-dione 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 2000mg, 5000mg, 10000mg.
1-(4-methoxyphenyl)-2-phenylethane-1,2-dione (CAS 22711-21-3) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-phenylethane-1,2-dione. InChIKey: NTINAJCDYRYMML-UHFFFAOYSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-phenylethane-1,2-dione |
| InChIKey | NTINAJCDYRYMML-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)