Products 82381-67-7
CAS 82381-67-7 is the registry number for Ro 31-0052. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]piperidin-3-ol (CAS 82381-67-7) is a chemical compound with the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. IUPAC name: 1-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]piperidin-3-ol. InChIKey: NZLBVURLEKAMKZ-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O4 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | 1-[2-hydroxy-3-(2-nitroimidazol-1-yl)propyl]piperidin-3-ol |
| InChIKey | NZLBVURLEKAMKZ-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC(CN2C=CN=C2[N+](=O)[O-])O)O |
Computed by PubChem (NCBI)