CAS 227619-65-0 appears in our catalog under these names: HIP-B, (±)–HIP–B, (±)-HIP-B. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, Get quote.
(3aS,6S,6aS)-3-oxo-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-6-carboxylic acid (CAS 227619-65-0) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: (3aS,6S,6aS)-3-oxo-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-6-carboxylic acid. InChIKey: IOOKKDXVJPSSSC-HZLVTQRSSA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | (3aS,6S,6aS)-3-oxo-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-6-carboxylic acid |
| InChIKey | IOOKKDXVJPSSSC-HZLVTQRSSA-N |
| SMILES | C1[C@H]2[C@@H]([C@H](N1)C(=O)O)ONC2=O |
Computed by PubChem (NCBI)