Products 2279124-49-9
CAS 2279124-49-9 appears in our catalog under these names: [(7-Methylimidazo[1,2-a]pyrimidin-2-yl)methyl]amine hydrochloride, 95%, (7-Methylimidazo(1,2-a)pyrimidin-2-yl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
(7-methylimidazo[1,2-a]pyrimidin-2-yl)methanamine;hydrochloride (CAS 2279124-49-9) is a chemical compound with the molecular formula C8H11ClN4 and a molecular weight of 198.65 g/mol. IUPAC name: (7-methylimidazo[1,2-a]pyrimidin-2-yl)methanamine;hydrochloride. InChIKey: YRDTWRDAONMYJV-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN4 |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | (7-methylimidazo[1,2-a]pyrimidin-2-yl)methanamine;hydrochloride |
| InChIKey | YRDTWRDAONMYJV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=CN2C=C1)CN.Cl |
Computed by PubChem (NCBI)