Products 22812-29-9
CAS 22812-29-9 is the registry number for Antibiofilm agent-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-oxo-2-phenylchromen-3-yl) benzoate (CAS 22812-29-9) is a chemical compound with the molecular formula C22H14O4 and a molecular weight of 342.3 g/mol. IUPAC name: (4-oxo-2-phenylchromen-3-yl) benzoate. InChIKey: MTHWZCUSVZVBSA-UHFFFAOYSA-N.
| Molecular formula | C22H14O4 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | (4-oxo-2-phenylchromen-3-yl) benzoate |
| InChIKey | MTHWZCUSVZVBSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)