CAS 2281857-11-0 is the registry number for (3R,4S)-1-(tert-Butoxycarbonyl)-4-(methoxycarbonyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2281857-11-0) is a chemical compound with the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. IUPAC name: (3R,4S)-4-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: NWRQXIQGLPCWCL-JGVFFNPUSA-N.
| Molecular formula | C12H19NO6 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | (3R,4S)-4-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | NWRQXIQGLPCWCL-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)