CAS 22819-07-4 appears in our catalog under these names: 5-Benzyl-1h-1,2,4-triazol-3-amine, 95%, 5-benzyl-4H-1,2,4-triazol-3-amine, 98%, 5-Benzyl-4H-1,2,4-triazol-3-amine, >95% (HPLC), 3-Benzyl-1H-1,2,4-triazol-5-amine 97%, 3-(Phenylmethyl)-1H-1,2,4-triazol-5-amine, 97%, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg, 500mg, 50mg.
5-benzyl-1H-1,2,4-triazol-3-amine (CAS 22819-07-4) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 5-benzyl-1H-1,2,4-triazol-3-amine. InChIKey: QGLMSZQOJZAPSZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-benzyl-1H-1,2,4-triazol-3-amine |
| InChIKey | QGLMSZQOJZAPSZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=NN2)N |
Computed by PubChem (NCBI)