CAS 25784-58-1 is the registry number for 1-Benzyl-1h-1,2,3-triazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-benzyltriazol-4-amine (CAS 25784-58-1) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 3-benzyltriazol-4-amine. InChIKey: QRRQLTWAXIGSDK-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 3-benzyltriazol-4-amine |
| InChIKey | QRRQLTWAXIGSDK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=CN=N2)N |
Computed by PubChem (NCBI)