CAS 51884-11-8 appears in our catalog under these names: 5-(4-Methylphenyl)-4h-1,2,4-triazol-3-amine, 95%, 3-(4-Methylphenyl)-1h-1,2,4-triazol-5-amine, 95%, 5-(p-Tolyl)-4H-1,2,4-triazol-3-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 25g, 250mg.
5-(4-methylphenyl)-1H-1,2,4-triazol-3-amine (CAS 51884-11-8) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 5-(4-methylphenyl)-1H-1,2,4-triazol-3-amine. InChIKey: OFNBXLBLUCECGY-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-(4-methylphenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | OFNBXLBLUCECGY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NN2)N |
Computed by PubChem (NCBI)