CAS 27018-16-2 appears in our catalog under these names: 2,4-Diamino-7-methylquinazoline, 95%, 7-Methylquinazoline-2,4-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
7-methylquinazoline-2,4-diamine (CAS 27018-16-2) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 7-methylquinazoline-2,4-diamine. InChIKey: ZUDXJVZWJQHECN-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 7-methylquinazoline-2,4-diamine |
| InChIKey | ZUDXJVZWJQHECN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)