CAS 68557-26-6 appears in our catalog under these names: 3-Methyl-1-phenyl-1h-1,2,4-triazol-5-amine, 95%, 3-Methyl-1-phenyl-1H-1,2,4-triazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
5-methyl-2-phenyl-1,2,4-triazol-3-amine (CAS 68557-26-6) is a chemical compound with the molecular formula C9H10N4 and a molecular weight of 174.20 g/mol. IUPAC name: 5-methyl-2-phenyl-1,2,4-triazol-3-amine. InChIKey: KJQUSZYWRCFSBC-UHFFFAOYSA-N.
| Molecular formula | C9H10N4 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-methyl-2-phenyl-1,2,4-triazol-3-amine |
| InChIKey | KJQUSZYWRCFSBC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=N1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)