CAS 686353-29-7 appears in our catalog under these names: 2-Deoxyguanosine-15N5, 8-Oxo-2’-deoxyguanosine-15N4, 2′-Deoxyguanosine-15N5, 2'-Deoxyguanosine-15N5. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 1 mg.
2-(15N)azanyl-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (CAS 686353-29-7) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 272.21 g/mol. IUPAC name: 2-(15N)azanyl-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one. InChIKey: YKBGVTZYEHREMT-ACCIVEAHSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | 2-(15N)azanyl-9-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| InChIKey | YKBGVTZYEHREMT-ACCIVEAHSA-N |
| SMILES | C1[C@H]([C@H](O[C@H]1[15N]2C=[15N]C3=C2[15N]=C([15NH]C3=O)[15NH2])CO)O |
Computed by PubChem (NCBI)