CAS 2284-30-2 appears in our catalog under these names: 4-Benzylresorcinol, 95%, 4-Benzylresorcinol, >97.0%(GC), 4-Benzylbenzene-1,3-diol, 4-Benzylbenzene-1,3-diol, 95+%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g.
4-benzylbenzene-1,3-diol (CAS 2284-30-2) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 4-benzylbenzene-1,3-diol. InChIKey: QVFIWTNWKHFVEH-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 4-benzylbenzene-1,3-diol |
| InChIKey | QVFIWTNWKHFVEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=C(C=C(C=C2)O)O |
Computed by PubChem (NCBI)