Products 2287236-88-6
CAS 2287236-88-6 is the registry number for tert-Butyl (3R,5S)-3,5-dimethoxymorpholine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl (3S,5R)-3,5-dimethoxymorpholine-4-carboxylate (CAS 2287236-88-6) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl (3S,5R)-3,5-dimethoxymorpholine-4-carboxylate. InChIKey: YVQMAMWNPFSRKW-DTORHVGOSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl (3S,5R)-3,5-dimethoxymorpholine-4-carboxylate |
| InChIKey | YVQMAMWNPFSRKW-DTORHVGOSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](COC[C@@H]1OC)OC |
Computed by PubChem (NCBI)