Products 2287266-73-1

CAS 2287266-73-1 is the registry number for Ethyl 2-amino-2-(oxan-2-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-2-(oxan-2-yl)acetate;hydrochloride (CAS 2287266-73-1) is a chemical compound with the molecular formula C9H18ClNO3 and a molecular weight of 223.70 g/mol. IUPAC name: ethyl 2-amino-2-(oxan-2-yl)acetate;hydrochloride. InChIKey: QXAPOCWUKCVDFU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO3
Molecular weight223.70 g/mol
IUPAC nameethyl 2-amino-2-(oxan-2-yl)acetate;hydrochloride
InChIKeyQXAPOCWUKCVDFU-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1CCCCO1)N.Cl

Computed by PubChem (NCBI)