Products 2287270-96-4
CAS 2287270-96-4 is the registry number for 2-((Benzyloxy)carbonyl)-2-azaspiro[4.4]nonane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenylmethoxycarbonyl-2-azaspiro[4.4]nonane-3-carboxylic acid (CAS 2287270-96-4) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: 2-phenylmethoxycarbonyl-2-azaspiro[4.4]nonane-3-carboxylic acid. InChIKey: HGFZFRUYVUKLFL-UHFFFAOYSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | 2-phenylmethoxycarbonyl-2-azaspiro[4.4]nonane-3-carboxylic acid |
| InChIKey | HGFZFRUYVUKLFL-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(N(C2)C(=O)OCC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)