Products 2287298-17-1

CAS 2287298-17-1 is the registry number for tert-Butyl N-{thieno(3,2-b)pyridin-2-yl}carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-thieno[3,2-b]pyridin-2-ylcarbamate (CAS 2287298-17-1) is a chemical compound with the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. IUPAC name: tert-butyl N-thieno[3,2-b]pyridin-2-ylcarbamate. InChIKey: DNNLKNZYPOCCKU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O2S
Molecular weight250.32 g/mol
IUPAC nametert-butyl N-thieno[3,2-b]pyridin-2-ylcarbamate
InChIKeyDNNLKNZYPOCCKU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC2=C(S1)C=CC=N2

Computed by PubChem (NCBI)