Products 22888-47-7
CAS 22888-47-7 appears in our catalog under these names: 2-Amino-3-(4-cyanophenyl)propanoic acid, 98%, 2-Amino-3-(4-cyanophenyl)propanoic acid, 95%, 95%, 2-Amino-3-(4-cyanophenyl)propanoic acid, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-amino-3-(4-cyanophenyl)propanoic acid (CAS 22888-47-7) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 2-amino-3-(4-cyanophenyl)propanoic acid. InChIKey: KWIPUXXIFQQMKN-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 2-amino-3-(4-cyanophenyl)propanoic acid |
| InChIKey | KWIPUXXIFQQMKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)C#N |
Computed by PubChem (NCBI)
Synonyms:
2-amino-3-(4-cyanophenyl)propanoic Acid, 4-Cyano-DL-Phenylalanine, 4-Cyanophenylalanine, Phenylalanine, 4-cyano-, h-4-cyano-phe-oh, 4-Cyano-D-Phenylalanine, 2-Amino-3-(4-cyanophenyl)propanoicacid, 4-Cyano-L-phenylalaine hydrochloride, 4-cyano-L-Phenylaminine, 4-Cyano-dl-phenylalanine (H-DL-Phe(4-CN)-OH)