CAS 2289694-26-2 appears in our catalog under these names: Ketorolac Impurity 8, Ketorolac Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
5-benzoyl-2-hydroxy-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid (CAS 2289694-26-2) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 5-benzoyl-2-hydroxy-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid. InChIKey: VLJJQOBXSOPHTM-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 5-benzoyl-2-hydroxy-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| InChIKey | VLJJQOBXSOPHTM-UHFFFAOYSA-N |
| SMILES | C1C(C(C2=CC=C(N21)C(=O)C3=CC=CC=C3)C(=O)O)O |
Computed by PubChem (NCBI)