Products 2293422-02-1
CAS 2293422-02-1 is the registry number for 1-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-2-fluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluoroethanone (CAS 2293422-02-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluoroethanone. InChIKey: RHFHRADCXNQMKK-UHFFFAOYSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-fluoroethanone |
| InChIKey | RHFHRADCXNQMKK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CF |
Computed by PubChem (NCBI)