CAS 22945-62-6 appears in our catalog under these names: Picosulfate Impurity 4, Picosulfate Impurity 17, Picosulfate Impurity 9, 2-(Pyridine-2-carbonyl)phenol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
(2-hydroxyphenyl)-pyridin-2-ylmethanone (CAS 22945-62-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: (2-hydroxyphenyl)-pyridin-2-ylmethanone. InChIKey: OQTXWHJGSGKFRD-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | (2-hydroxyphenyl)-pyridin-2-ylmethanone |
| InChIKey | OQTXWHJGSGKFRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=N2)O |
Computed by PubChem (NCBI)