CAS 22955-07-3 appears in our catalog under these names: 4-(Benzyloxy)-3-nitrobenzaldehyde 97%, 4-(Benzyloxy)-3-nitrobenzaldehyde, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3-nitro-4-phenylmethoxybenzaldehyde (CAS 22955-07-3) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-nitro-4-phenylmethoxybenzaldehyde. InChIKey: VJANVDWJMIGNFW-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-nitro-4-phenylmethoxybenzaldehyde |
| InChIKey | VJANVDWJMIGNFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)