Products 2295921-93-4
CAS 2295921-93-4 is the registry number for 2-Cyclobutyl-N,N-dimethyl-2-oxoethane-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-cyclobutyl-N,N-dimethyl-2-oxoethanesulfonamide (CAS 2295921-93-4) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: 2-cyclobutyl-N,N-dimethyl-2-oxoethanesulfonamide. InChIKey: BOFKVVSYCTZHDS-UHFFFAOYSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 2-cyclobutyl-N,N-dimethyl-2-oxoethanesulfonamide |
| InChIKey | BOFKVVSYCTZHDS-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)CC(=O)C1CCC1 |
Computed by PubChem (NCBI)