CAS 22974-74-9 appears in our catalog under these names: N,3-Dihydroxynaphthalene-2-carboxamide, 95%, N,3-Dihydroxynaphthalene-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N,3-dihydroxynaphthalene-2-carboxamide (CAS 22974-74-9) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: N,3-dihydroxynaphthalene-2-carboxamide. InChIKey: BVXHPRFAVBFDIA-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | N,3-dihydroxynaphthalene-2-carboxamide |
| InChIKey | BVXHPRFAVBFDIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NO)O |
Computed by PubChem (NCBI)