Products 22988-52-9
CAS 22988-52-9 appears in our catalog under these names: 4-(5-Methyl-2-thienyl)-4-oxobutyric acid, 95%, 4-(5-Methyl-thiophen-2-yl)-4-oxo-butyric acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g, 0,5g.
4-(5-methylthiophen-2-yl)-4-oxobutanoic acid (CAS 22988-52-9) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 4-(5-methylthiophen-2-yl)-4-oxobutanoic acid. InChIKey: BBGWOJJYYCDOAN-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 4-(5-methylthiophen-2-yl)-4-oxobutanoic acid |
| InChIKey | BBGWOJJYYCDOAN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(5-methylthiophen-2-yl)-4-oxobutanoic acid, 4-(5-Methyl-2-thienyl)-4-oxobutyric acid, 4-(5-Methyl-thiophen-2-yl)-4-oxo-butyric acid, 2-Thiophenebutanoic acid, 5-methyl-gamma-oxo-, 4-(5-methyl(2-thienyl))-4-oxobutanoic acid, 4-(5-Methyl-2-thienyl)-4-oxobutanoic Acid, 4-(5-methyl-2-thienyl)-4-oxo-butanoic acid, 4-(5-methylthiophen-2-yl)-4-oxobutanoicacid