CAS 229948-67-8 appears in our catalog under these names: 4-Bromotoluene-d7, 98 atom % D, min 98% Chemical Purity, 4–BROMOTOLUENE–D7. Offered by: CDN, GLPBio. Available pack sizes: 0,5g, 0,25g, 25mg.
1-bromo-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene (CAS 229948-67-8) is a chemical compound with the molecular formula C7H7Br and a molecular weight of 178.08 g/mol. IUPAC name: 1-bromo-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene. InChIKey: ZBTMRBYMKUEVEU-AAYPNNLASA-N.
| Molecular formula | C7H7Br |
|---|---|
| Molecular weight | 178.08 g/mol |
| IUPAC name | 1-bromo-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene |
| InChIKey | ZBTMRBYMKUEVEU-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)