CAS 23012-16-0 appears in our catalog under these names: 2-Phenyl-1,3-oxazole-4-carboxylic acid, 98%, 2-Phenyloxazole-4-carboxylic acid, 95%, 2-Phenyloxazole-4-carboxylic acid, 2-Phenyloxazole-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 25g, 1g, 100mg.
2-phenyl-1,3-oxazole-4-carboxylic acid (CAS 23012-16-0) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 2-phenyl-1,3-oxazole-4-carboxylic acid. InChIKey: KQRWYYSDIFOTTP-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-phenyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | KQRWYYSDIFOTTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)C(=O)O |
Computed by PubChem (NCBI)