Products 2301881-37-6
CAS 2301881-37-6 appears in our catalog under these names: (R)-1-(4-(Difluoromethyl)phenyl)ethan-1-amine hydrochloride, 97%, 97%, (R)-1-(4-(Difluoromethyl)phenyl)ethan-1-amine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-[4-(difluoromethyl)phenyl]ethanamine;hydrochloride (CAS 2301881-37-6) is a chemical compound with the molecular formula C9H12ClF2N and a molecular weight of 207.65 g/mol. IUPAC name: (1R)-1-[4-(difluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: OKRHMDPVPVWGCO-FYZOBXCZSA-N.
| Molecular formula | C9H12ClF2N |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | (1R)-1-[4-(difluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | OKRHMDPVPVWGCO-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(F)F)N.Cl |
Computed by PubChem (NCBI)