Products 230301-61-8
CAS 230301-61-8 is the registry number for tert-Butyl 2-carbamoyl-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2-carbamoyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate (CAS 230301-61-8) is a chemical compound with the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. IUPAC name: tert-butyl 2-carbamoyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate. InChIKey: WNASTMXQUJOXDJ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O3S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | tert-butyl 2-carbamoyl-6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxylate |
| InChIKey | WNASTMXQUJOXDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(S2)C(=O)N |
Computed by PubChem (NCBI)