Products 2303538-30-7
CAS 2303538-30-7 is the registry number for 5-(3,5-Dichlorophenyl)-3,4-dihydro-2H-pyrrole, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
5-(3,5-dichlorophenyl)-3,4-dihydro-2H-pyrrole (CAS 2303538-30-7) is a chemical compound with the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. IUPAC name: 5-(3,5-dichlorophenyl)-3,4-dihydro-2H-pyrrole. InChIKey: FMKUPHITIIBDJI-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N |
|---|---|
| Molecular weight | 214.09 g/mol |
| IUPAC name | 5-(3,5-dichlorophenyl)-3,4-dihydro-2H-pyrrole |
| InChIKey | FMKUPHITIIBDJI-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)