CAS 2305078-79-7 appears in our catalog under these names: tert-Butyl ((2R,4S)-2-methylpiperidin-4-yl)carbamate hydrochloride, 97%, tert-butyl N-[(2R,4S)-2-methyl-4-piperidyl]carbamate,hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Tert-butyl N-[(2R,4S)-2-methylpiperidin-4-yl]carbamate;hydrochloride (CAS 2305078-79-7) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-[(2R,4S)-2-methylpiperidin-4-yl]carbamate;hydrochloride. InChIKey: AAXPAHGOEJLWNJ-RJUBDTSPSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl N-[(2R,4S)-2-methylpiperidin-4-yl]carbamate;hydrochloride |
| InChIKey | AAXPAHGOEJLWNJ-RJUBDTSPSA-N |
| SMILES | C[C@@H]1C[C@H](CCN1)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)