CAS 2305080-41-3 appears in our catalog under these names: tert-Butyl (S)-(1-(4-bromo-2-methylphenyl)ethyl)carbamate, 95%, 95%, (S)-[1-(4-Bromo-2-methyl-phenyl)-ethyl]-carbamic acid tert-butyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Tert-butyl N-[(1S)-1-(4-bromo-2-methylphenyl)ethyl]carbamate (CAS 2305080-41-3) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: tert-butyl N-[(1S)-1-(4-bromo-2-methylphenyl)ethyl]carbamate. InChIKey: ANJGLIPDEKZXIW-JTQLQIEISA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-(4-bromo-2-methylphenyl)ethyl]carbamate |
| InChIKey | ANJGLIPDEKZXIW-JTQLQIEISA-N |
| SMILES | CC1=C(C=CC(=C1)Br)[C@H](C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)