Products 23051-08-3

CAS 23051-08-3 is the registry number for 8-Hydroxy-2-methylquinoline-7-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

8-hydroxy-2-methylquinoline-7-carboxylic acid (CAS 23051-08-3) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 8-hydroxy-2-methylquinoline-7-carboxylic acid. InChIKey: SHOHIXCIFBPUAP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO3
Molecular weight203.19 g/mol
IUPAC name8-hydroxy-2-methylquinoline-7-carboxylic acid
InChIKeySHOHIXCIFBPUAP-UHFFFAOYSA-N
SMILESCC1=NC2=C(C=C1)C=CC(=C2O)C(=O)O

Computed by PubChem (NCBI)