CAS 2305147-99-1 is the registry number for rac-(5R,8R)-3-Methyl-2,4-dioxo-1,3-diazaspiro(4.5)decane-8-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxylic acid (CAS 2305147-99-1) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: 3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxylic acid. InChIKey: YYKOCAIZLCHVDC-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxylic acid |
| InChIKey | YYKOCAIZLCHVDC-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2(CCC(CC2)C(=O)O)NC1=O |
Computed by PubChem (NCBI)