CAS 23056-49-7 is the registry number for 4-Bromo-2-methyl-3-nitropyridine, 95+%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
4-bromo-2-methyl-3-nitropyridine (CAS 23056-49-7) is a chemical compound with the molecular formula C6H5BrN2O2 and a molecular weight of 217.02 g/mol. IUPAC name: 4-bromo-2-methyl-3-nitropyridine. InChIKey: HLWBVEFKUQEPPM-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O2 |
|---|---|
| Molecular weight | 217.02 g/mol |
| IUPAC name | 4-bromo-2-methyl-3-nitropyridine |
| InChIKey | HLWBVEFKUQEPPM-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)