CAS 2306255-55-8 appears in our catalog under these names: (2R,4R)-4-Fluoro-2-methylpiperidine hydrochloride, 95%, (2R,4R)-4-Fluoro-2-methylpiperidine hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 500mg.
(2R,4R)-4-fluoro-2-methylpiperidine;hydrochloride (CAS 2306255-55-8) is a chemical compound with the molecular formula C6H13ClFN and a molecular weight of 153.62 g/mol. IUPAC name: (2R,4R)-4-fluoro-2-methylpiperidine;hydrochloride. InChIKey: FLPHBJKZYAFDDP-KGZKBUQUSA-N.
| Molecular formula | C6H13ClFN |
|---|---|
| Molecular weight | 153.62 g/mol |
| IUPAC name | (2R,4R)-4-fluoro-2-methylpiperidine;hydrochloride |
| InChIKey | FLPHBJKZYAFDDP-KGZKBUQUSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)F.Cl |
Computed by PubChem (NCBI)