Products 2307779-13-9
CAS 2307779-13-9 is the registry number for rac-4-((3R,4R)-4-Methoxypyrrolidin-3-yl)-1H-1,2,3-triazole dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole;dihydrochloride (CAS 2307779-13-9) is a chemical compound with the molecular formula C7H14Cl2N4O and a molecular weight of 241.12 g/mol. IUPAC name: 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole;dihydrochloride. InChIKey: KBUVRXWCHPLYBQ-HKIOLEONSA-N.
| Molecular formula | C7H14Cl2N4O |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 4-[(3S,4S)-4-methoxypyrrolidin-3-yl]-2H-triazole;dihydrochloride |
| InChIKey | KBUVRXWCHPLYBQ-HKIOLEONSA-N |
| SMILES | CO[C@@H]1CNC[C@H]1C2=NNN=C2.Cl.Cl |
Computed by PubChem (NCBI)