CAS 23082-51-1 appears in our catalog under these names: 1–(4–Chloro–2–nitrophenyl)ethanone, 1-(4-Chloro-2-nitrophenyl)ethanone, 98%, 4'-Chloro-2'-nitroacetophenone, >98.0%(GC), 1-(4-Chloro-2-nitrophenyl)ethanone, 98%, 98%. Offered by: GLPBio, Fluorochem, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
1-(4-chloro-2-nitrophenyl)ethanone (CAS 23082-51-1) is a chemical compound with the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. IUPAC name: 1-(4-chloro-2-nitrophenyl)ethanone. InChIKey: PUUYGMZERWRIDS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO3 |
|---|---|
| Molecular weight | 199.59 g/mol |
| IUPAC name | 1-(4-chloro-2-nitrophenyl)ethanone |
| InChIKey | PUUYGMZERWRIDS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)