Products 2308544-01-4
CAS 2308544-01-4 is the registry number for 1-(METHYL-D3)-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trideuteriomethyl)pyrazole (CAS 2308544-01-4) is a chemical compound with the molecular formula C10H17BN2O2 and a molecular weight of 211.09 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trideuteriomethyl)pyrazole. InChIKey: HLXOVAMYQUFLPE-VPYROQPTSA-N.
| Molecular formula | C10H17BN2O2 |
|---|---|
| Molecular weight | 211.09 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(trideuteriomethyl)pyrazole |
| InChIKey | HLXOVAMYQUFLPE-VPYROQPTSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=CC=N1)B2OC(C(O2)(C)C)(C)C |
Computed by PubChem (NCBI)