Products 2309455-52-3
CAS 2309455-52-3 is the registry number for Methyl 3-(3-chlorophenyl)pyrrolidine-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 3-(3-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 2309455-52-3) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: methyl 3-(3-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: ODQQSGGIAVXABM-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | methyl 3-(3-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | ODQQSGGIAVXABM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCNC1)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)