Products 2309459-81-0
CAS 2309459-81-0 is the registry number for 2,8-Dimethyl-5H,6H,7H,8H-imidazo(1,2-a)pyridine-6-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride (CAS 2309459-81-0) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: 2,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride. InChIKey: BWKHVUOJDJWOFM-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2,8-dimethyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride |
| InChIKey | BWKHVUOJDJWOFM-UHFFFAOYSA-N |
| SMILES | CC1CC(CN2C1=NC(=C2)C)C(=O)O.Cl |
Computed by PubChem (NCBI)